C20H15F7O3 — CID 158924731
1-[2-methoxy-5-(2-oxopropyl)phenyl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 158924731) has the molecular formula C20H15F7O3 and a molecular weight of 436.32 g/mol. Its IUPAC name is 1-[2-methoxy-5-(2-oxopropyl)phenyl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-[2-methoxy-5-(2-oxopropyl)phenyl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 158924731 |
| Molecular Formula | C20H15F7O3 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-[2-methoxy-5-(2-oxopropyl)phenyl]-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | COc1ccc(CC(C)=O)cc1CC(=O)Cc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C20H15F7O3/c1-9(28)5-10-3-4-14(30-2)11(6-10)7-12(29)8-13-16(21)18(23)15(20(25,26)27)19(24)17(13)22/h3-4,6H,5,7-8H2,1-2H3 |
| InChIKey | JIHFTMYVRZBAJS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|