C27H22ClN5O5S2 — CID 158926706
4-chloro-3-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide;5-(2-methylphenyl)-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 158926706) has the molecular formula C27H22ClN5O5S2 and a molecular weight of 596.09 g/mol. Its IUPAC name is 4-chloro-3-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide;5-(2-methylphenyl)-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide.
| Compound Name | 4-chloro-3-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide;5-(2-methylphenyl)-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 158926706 |
| Molecular Formula | C27H22ClN5O5S2 |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | 4-chloro-3-methyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide;5-(2-methylphenyl)-N-(5-methyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ncc([N+](=O)[O-])s2)ccc1Cl.Cc1cnc(NC(=O)c2ccc(-c3ccccc3C)o2)s1 |
| InChI | InChI=1S/C16H14N2O2S.C11H8ClN3O3S/c1-10-5-3-4-6-12(10)13-7-8-14(20-13)15(19)18-16-17-9-11(2)21-16;1-6-4-7(2-3-8(6)12)10(16)14-11-13-5-9(19-11)15(17)18/h3-9H,1-2H3,(H,17,18,19);2-5H,1H3,(H,13,14,16) |
| InChIKey | JINOSHBNZHWVEJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|