C21H26N2O5 — CID 158928090
acetylene;4-amino-2-hydroxy-2-[2-(1H-indol-3-yl)ethyl]pentanedioic acid;but-2-yne (PubChem CID 158928090) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is acetylene;4-amino-2-hydroxy-2-[2-(1H-indol-3-yl)ethyl]pentanedioic acid;but-2-yne.
| Compound Name | acetylene;4-amino-2-hydroxy-2-[2-(1H-indol-3-yl)ethyl]pentanedioic acid;but-2-yne |
|---|---|
| PubChem CID | 158928090 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | acetylene;4-amino-2-hydroxy-2-[2-(1H-indol-3-yl)ethyl]pentanedioic acid;but-2-yne |
| SMILES | C#C.CC#CC.NC(CC(O)(CCc1c[nH]c2ccccc12)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H18N2O5.C4H6.C2H2/c16-11(13(18)19)7-15(22,14(20)21)6-5-9-8-17-12-4-2-1-3-10(9)12;1-3-4-2;1-2/h1-4,8,11,17,22H,5-7,16H2,(H,18,19)(H,20,21);1-2H3;1-2H |
| InChIKey | JIRRIAMVBBLDMZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|