C25H31NO4S — CID 158929679
S-[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butyl] ethanethioate (PubChem CID 158929679) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is S-[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butyl] ethanethioate.
| Compound Name | S-[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butyl] ethanethioate |
|---|---|
| PubChem CID | 158929679 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | S-[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](C)OC(C)(C)C |
| InChI | InChI=1S/C25H31NO4S/c1-16(30-25(3,4)5)23(15-31-17(2)27)26-24(28)29-14-22-20-12-8-6-10-18(20)19-11-7-9-13-21(19)22/h6-13,16,22-23H,14-15H2,1-5H3,(H,26,28)/t16-,23-/m1/s1 |
| InChIKey | URBCNBTWHPKWRK-WAIKUNEKSA-N |
| XLogP | 5.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|