C7H3ClF4 — CID 15893033
1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene (PubChem CID 15893033) has the molecular formula C7H3ClF4 and a molecular weight of 198.55 g/mol. Its IUPAC name is 1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene.
| Compound Name | 1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene |
|---|---|
| PubChem CID | 15893033 |
| Molecular Formula | C7H3ClF4 |
| Molecular Weight | 198.55 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 1-chloro-2,3,5,6-tetrafluoro-4-methylbenzene |
| SMILES | Cc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C7H3ClF4/c1-2-4(9)6(11)3(8)7(12)5(2)10/h1H3 |
| InChIKey | PEVAKFLYJORONK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|