methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate

C15H20O4 — CID 15893367

IUPACmethyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate
SMILESCCCOc1cc2c(cc1OC)CC(C(=O)OC)C2
InChIInChI=1S/C15H20O4/c1-4-5-19-14-9-11-7-12(15(16)18-3)6-10(11)8-13(14)17-2/h8-9,12H,4-7H2,1-3H3
InChIKeyBQUWIXUPKSNERC-UHFFFAOYSA-N
MW264.32 g/mol
LogP2.37
Rot. Bonds5

About methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate

methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 15893367) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate
PubChem CID15893367
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Namemethyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate
SMILESCCCOc1cc2c(cc1OC)CC(C(=O)OC)C2
InChIInChI=1S/C15H20O4/c1-4-5-19-14-9-11-7-12(15(16)18-3)6-10(11)8-13(14)17-2/h8-9,12H,4-7H2,1-3H3
InChIKeyBQUWIXUPKSNERC-UHFFFAOYSA-N
XLogP2.37
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 52.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate?
The IUPAC name of methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate (CID 15893367) is methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate.
What is the SMILES notation for methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate?
The canonical SMILES for methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate is CCCOc1cc2c(cc1OC)CC(C(=O)OC)C2.
What is the InChIKey of methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate?
The InChIKey is BQUWIXUPKSNERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-4-5-19-14-9-11-7-12(15(16)18-3)6-10(11)8-13(14)17-2/h8-9,12H,4-7H2,1-3H3.
What are the key properties of methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate?
methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate has a molecular weight of 264.32 g/mol, XLogP of 2.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxy-6-propoxy-2,3-dihydro-1H-indene-2-carboxylate is sourced from PubChem (CID 15893367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).