C16H26O6 — CID 158934006
(E,2R,5R)-7-methoxy-5-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-7-oxohept-3-enoic acid (PubChem CID 158934006) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (E,2R,5R)-7-methoxy-5-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-7-oxohept-3-enoic acid.
| Compound Name | (E,2R,5R)-7-methoxy-5-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-7-oxohept-3-enoic acid |
|---|---|
| PubChem CID | 158934006 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (E,2R,5R)-7-methoxy-5-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-7-oxohept-3-enoic acid |
| SMILES | COC(=O)C[C@@H](C)/C=C/C(CCC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H26O6/c1-11(10-14(18)21-5)6-7-12(15(19)20)8-9-13(17)22-16(2,3)4/h6-7,11-12H,8-10H2,1-5H3,(H,19,20)/b7-6+/t11-,12?/m0/s1 |
| InChIKey | RSVORHPZQLWVBJ-AFZBGIBSSA-N |
| XLogP | 2.56 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|