C19H37GdN4O5+2 — CID 158936232
2-[4,7-diethyl-10-[2-hydroxy-2-(2-oxopropoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 158936232) has the molecular formula C19H37GdN4O5+2 and a molecular weight of 558.78 g/mol. Its IUPAC name is 2-[4,7-diethyl-10-[2-hydroxy-2-(2-oxopropoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4,7-diethyl-10-[2-hydroxy-2-(2-oxopropoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 158936232 |
| Molecular Formula | C19H37GdN4O5+2 |
| Molecular Weight | 558.78 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 2-[4,7-diethyl-10-[2-hydroxy-2-(2-oxopropoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | CCN1CCN(CC)CCN(CC(O)OCC(C)=O)CCN(CC(=O)[O-])CC1.[Gd+3] |
| InChI | InChI=1S/C19H38N4O5.Gd/c1-4-20-6-7-21(5-2)9-11-23(15-19(27)28-16-17(3)24)13-12-22(10-8-20)14-18(25)26;/h19,27H,4-16H2,1-3H3,(H,25,26);/q;+3/p-1 |
| InChIKey | JJRJXXLEEODHOO-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.78 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|