C28H30N6 — CID 158936254
(1R)-4'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine (PubChem CID 158936254) has the molecular formula C28H30N6 and a molecular weight of 450.59 g/mol. Its IUPAC name is (1R)-4'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine.
| Compound Name | (1R)-4'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine |
|---|---|
| PubChem CID | 158936254 |
| Molecular Formula | C28H30N6 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (1R)-4'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine |
| SMILES | N[C@H]1c2ccccc2CC12CCC(c1cnc3c(n1)CN=C3N1CCCc3ncccc31)CC2 |
| InChI | InChI=1S/C28H30N6/c29-26-20-6-2-1-5-19(20)15-28(26)11-9-18(10-12-28)22-16-31-25-23(33-22)17-32-27(25)34-14-4-7-21-24(34)8-3-13-30-21/h1-3,5-6,8,13,16,18,26H,4,7,9-12,14-15,17,29H2/t18?,26-,28?/m0/s1 |
| InChIKey | IFBHZUPQQYGPNW-YBTNAAQZSA-N |
| XLogP | 4.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |