C29H31N7 — CID 167539373
(1S,1'S,5'R)-8'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,3'-8-azabicyclo[3.2.1]octane]-1-amine (PubChem CID 167539373) has the molecular formula C29H31N7 and a molecular weight of 477.62 g/mol. Its IUPAC name is (1S,1'S,5'R)-8'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,3'-8-azabicyclo[3.2.1]octane]-1-amine.
| Compound Name | (1S,1'S,5'R)-8'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,3'-8-azabicyclo[3.2.1]octane]-1-amine |
|---|---|
| PubChem CID | 167539373 |
| Molecular Formula | C29H31N7 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | (1S,1'S,5'R)-8'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,3'-8-azabicyclo[3.2.1]octane]-1-amine |
| SMILES | N[C@@H]1c2ccccc2CC12C[C@H]1CC[C@@H](C2)N1c1cnc2c(n1)CN=C2N1CCCc2ncccc21 |
| InChI | InChI=1S/C29H31N7/c30-27-21-6-2-1-5-18(21)13-29(27)14-19-9-10-20(15-29)36(19)25-17-32-26-23(34-25)16-33-28(26)35-12-4-7-22-24(35)8-3-11-31-22/h1-3,5-6,8,11,17,19-20,27H,4,7,9-10,12-16,30H2/t19-,20+,27-,29?/m1/s1 |
| InChIKey | UGXCFXAIDDDXAI-LBPKCPQSSA-N |
| XLogP | 3.96 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |