C28H28N8 — CID 161452087
(1S)-1-amino-1'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-4-carbonitrile (PubChem CID 161452087) has the molecular formula C28H28N8 and a molecular weight of 476.59 g/mol. Its IUPAC name is (1S)-1-amino-1'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-4-carbonitrile.
| Compound Name | (1S)-1-amino-1'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-4-carbonitrile |
|---|---|
| PubChem CID | 161452087 |
| Molecular Formula | C28H28N8 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (1S)-1-amino-1'-[7-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5H-pyrrolo[3,4-b]pyrazin-3-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-4-carbonitrile |
| SMILES | N#Cc1cccc2c1CC1(CCN(c3cnc4c(n3)CN=C4N3CCCc4ncccc43)CC1)[C@@H]2N |
| InChI | InChI=1S/C28H28N8/c29-15-18-4-1-5-19-20(18)14-28(26(19)30)8-12-35(13-9-28)24-17-32-25-22(34-24)16-33-27(25)36-11-3-6-21-23(36)7-2-10-31-21/h1-2,4-5,7,10,17,26H,3,6,8-9,11-14,16,30H2/t26-/m1/s1 |
| InChIKey | DNOOXLGHVWPYPT-AREMUKBSSA-N |
| XLogP | 3.30 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |