C12H20N4O — CID 158936443
(1-cyano-3,3,5,5-tetramethylcyclohexyl)iminourea (PubChem CID 158936443) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is (1-cyano-3,3,5,5-tetramethylcyclohexyl)iminourea.
| Compound Name | (1-cyano-3,3,5,5-tetramethylcyclohexyl)iminourea |
|---|---|
| PubChem CID | 158936443 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1-cyano-3,3,5,5-tetramethylcyclohexyl)iminourea |
| SMILES | CC1(C)CC(C)(C)CC(C#N)(/N=N/C(N)=O)C1 |
| InChI | InChI=1S/C12H20N4O/c1-10(2)5-11(3,4)7-12(6-10,8-13)16-15-9(14)17/h5-7H2,1-4H3,(H2,14,17)/b16-15+ |
| InChIKey | JJRZNGYLINXRAS-FOCLMDBBSA-N |
| XLogP | 3.02 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|