C7H4N4O — CID 26412689
(1R)-1,2,2-tricyanocyclopropane-1-carboxamide (PubChem CID 26412689) has the molecular formula C7H4N4O and a molecular weight of 160.14 g/mol. Its IUPAC name is (1R)-1,2,2-tricyanocyclopropane-1-carboxamide.
| Compound Name | (1R)-1,2,2-tricyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 26412689 |
| Molecular Formula | C7H4N4O |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (1R)-1,2,2-tricyanocyclopropane-1-carboxamide |
| SMILES | N#CC1(C#N)C[C@@]1(C#N)C(N)=O |
| InChI | InChI=1S/C7H4N4O/c8-2-6(3-9)1-7(6,4-10)5(11)12/h1H2,(H2,11,12)/t7-/m1/s1 |
| InChIKey | UUQTVALIVPDXHM-SSDOTTSWSA-N |
| XLogP | -0.58 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |