C9H6N4O2 — CID 133064348
3,3,4-tricyano-2H-pyran-4-carboxamide (PubChem CID 133064348) has the molecular formula C9H6N4O2 and a molecular weight of 202.17 g/mol. Its IUPAC name is 3,3,4-tricyano-2H-pyran-4-carboxamide.
| Compound Name | 3,3,4-tricyano-2H-pyran-4-carboxamide |
|---|---|
| PubChem CID | 133064348 |
| Molecular Formula | C9H6N4O2 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3,3,4-tricyano-2H-pyran-4-carboxamide |
| SMILES | N#CC1(C#N)COC=CC1(C#N)C(N)=O |
| InChI | InChI=1S/C9H6N4O2/c10-3-8(4-11)6-15-2-1-9(8,5-12)7(13)14/h1-2H,6H2,(H2,13,14) |
| InChIKey | MRSGSTOZBFAAFU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |