C7H8Br2N2O — CID 6932728
cis-(3R,4S)-3,4-dibromo-1-cyanocyclopentane-1-carboxamide (PubChem CID 6932728) has the molecular formula C7H8Br2N2O and a molecular weight of 295.96 g/mol. Its IUPAC name is cis-(3R,4S)-3,4-dibromo-1-cyanocyclopentane-1-carboxamide.
| Compound Name | cis-(3R,4S)-3,4-dibromo-1-cyanocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 6932728 |
| Molecular Formula | C7H8Br2N2O |
| Molecular Weight | 295.96 g/mol |
| Exact Mass | 293.90 |
| IUPAC Name | cis-(3R,4S)-3,4-dibromo-1-cyanocyclopentane-1-carboxamide |
| SMILES | N#CC1(C(N)=O)C[C@@H](Br)[C@@H](Br)C1 |
| InChI | InChI=1S/C7H8Br2N2O/c8-4-1-7(3-10,6(11)12)2-5(4)9/h4-5H,1-2H2,(H2,11,12)/t4-,5+,7? |
| InChIKey | AJRQOPKXIAMEGM-VAPWPJCZSA-N |
| XLogP | 1.30 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.96 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|