C28H25N3O4S — CID 158938695
N-[(10-methylacridin-10-ium-9-yl)methylideneamino]-N-phenylaniline;methyl sulfate (PubChem CID 158938695) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[(10-methylacridin-10-ium-9-yl)methylideneamino]-N-phenylaniline;methyl sulfate.
| Compound Name | N-[(10-methylacridin-10-ium-9-yl)methylideneamino]-N-phenylaniline;methyl sulfate |
|---|---|
| PubChem CID | 158938695 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[(10-methylacridin-10-ium-9-yl)methylideneamino]-N-phenylaniline;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[n+]1c2ccccc2c(C=NN(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H22N3.CH4O4S/c1-29-26-18-10-8-16-23(26)25(24-17-9-11-19-27(24)29)20-28-30(21-12-4-2-5-13-21)22-14-6-3-7-15-22;1-5-6(2,3)4/h2-20H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | JJYYUICNBXDBCI-UHFFFAOYSA-M |
| XLogP | 5.08 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|