About diphenylphosphanium;methyl sulfate
diphenylphosphanium;methyl sulfate (PubChem CID 158280708) has the molecular formula C13H15O4PS
and a molecular weight of 298.30 g/mol. Its IUPAC name is diphenylphosphanium;methyl sulfate.
Molecular Properties
| Compound Name | diphenylphosphanium;methyl sulfate |
| PubChem CID | 158280708 |
| Molecular Formula | C13H15O4PS |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | diphenylphosphanium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].c1ccc([PH2+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.CH4O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-6(2,3)4/h1-10,13H;1H3,(H,2,3,4) |
| InChIKey | GKEDQFSETMBSOI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphanium;methyl sulfate?
The IUPAC name of diphenylphosphanium;methyl sulfate (CID 158280708) is diphenylphosphanium;methyl sulfate.
What is the SMILES notation for diphenylphosphanium;methyl sulfate?
The canonical SMILES for diphenylphosphanium;methyl sulfate is COS(=O)(=O)[O-].c1ccc([PH2+]c2ccccc2)cc1.
What is the InChIKey of diphenylphosphanium;methyl sulfate?
The InChIKey is GKEDQFSETMBSOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.CH4O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-6(2,3)4/h1-10,13H;1H3,(H,2,3,4).
What are the key properties of diphenylphosphanium;methyl sulfate?
diphenylphosphanium;methyl sulfate has a molecular weight of 298.30 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphanium;methyl sulfate is sourced from PubChem (CID 158280708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).