C12H15NO5S — CID 135052818
2,5-dimethyl-3-phenyl-1,2-oxazol-2-ium;methyl sulfate (PubChem CID 135052818) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2,5-dimethyl-3-phenyl-1,2-oxazol-2-ium;methyl sulfate.
| Compound Name | 2,5-dimethyl-3-phenyl-1,2-oxazol-2-ium;methyl sulfate |
|---|---|
| PubChem CID | 135052818 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2,5-dimethyl-3-phenyl-1,2-oxazol-2-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cc1cc(-c2ccccc2)[n+](C)o1 |
| InChI | InChI=1S/C11H12NO.CH4O4S/c1-9-8-11(12(2)13-9)10-6-4-3-5-7-10;1-5-6(2,3)4/h3-8H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BCZFLTZUXSQOBO-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 83.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|