C18H20N2O4S — CID 141066678
1,1-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate (PubChem CID 141066678) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1,1-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate.
| Compound Name | 1,1-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate |
|---|---|
| PubChem CID | 141066678 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1,1-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C)N=C(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C17H17N2.CH4O4S/c1-19(2)17(15-11-7-4-8-12-15)13-16(18-19)14-9-5-3-6-10-14;1-5-6(2,3)4/h3-13H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | DGFDVESNSQBCMR-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|