C18H25N5O4S — CID 157475342
methyl sulfate;2-N,4-N,2-trimethyl-3,5-diphenyl-3H-1,2,4-triazol-2-ium-2,4-diamine (PubChem CID 157475342) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is methyl sulfate;2-N,4-N,2-trimethyl-3,5-diphenyl-3H-1,2,4-triazol-2-ium-2,4-diamine.
| Compound Name | methyl sulfate;2-N,4-N,2-trimethyl-3,5-diphenyl-3H-1,2,4-triazol-2-ium-2,4-diamine |
|---|---|
| PubChem CID | 157475342 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | methyl sulfate;2-N,4-N,2-trimethyl-3,5-diphenyl-3H-1,2,4-triazol-2-ium-2,4-diamine |
| SMILES | CNN1C(c2ccccc2)=N[N+](C)(NC)C1c1ccccc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H22N5.CH4O4S/c1-18-21-16(14-10-6-4-7-11-14)20-22(3,19-2)17(21)15-12-8-5-9-13-15;1-5-6(2,3)4/h4-13,17-19H,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BVNCQUGMTJTMHE-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|