About (2-methylphenyl)azanium;methyl sulfate
(2-methylphenyl)azanium;methyl sulfate (PubChem CID 141118228) has the molecular formula C8H13NO4S
and a molecular weight of 219.26 g/mol. Its IUPAC name is (2-methylphenyl)azanium;methyl sulfate.
Molecular Properties
| Compound Name | (2-methylphenyl)azanium;methyl sulfate |
| PubChem CID | 141118228 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2-methylphenyl)azanium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cc1ccccc1[NH3+] |
| InChI | InChI=1S/C7H9N.CH4O4S/c1-6-4-2-3-5-7(6)8;1-5-6(2,3)4/h2-5H,8H2,1H3;1H3,(H,2,3,4) |
| InChIKey | RGRSWECUZIBJHQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)azanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)azanium;methyl sulfate?
The IUPAC name of (2-methylphenyl)azanium;methyl sulfate (CID 141118228) is (2-methylphenyl)azanium;methyl sulfate.
What is the SMILES notation for (2-methylphenyl)azanium;methyl sulfate?
The canonical SMILES for (2-methylphenyl)azanium;methyl sulfate is COS(=O)(=O)[O-].Cc1ccccc1[NH3+].
What is the InChIKey of (2-methylphenyl)azanium;methyl sulfate?
The InChIKey is RGRSWECUZIBJHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.CH4O4S/c1-6-4-2-3-5-7(6)8;1-5-6(2,3)4/h2-5H,8H2,1H3;1H3,(H,2,3,4).
What are the key properties of (2-methylphenyl)azanium;methyl sulfate?
(2-methylphenyl)azanium;methyl sulfate has a molecular weight of 219.26 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)azanium;methyl sulfate is sourced from PubChem (CID 141118228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).