C18H30N2O8S2 — CID 88833689
5-hexyl-1,2-dimethyl-3-phenylpyrazol-2-ium;methyl sulfate;sulfuric acid (PubChem CID 88833689) has the molecular formula C18H30N2O8S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is 5-hexyl-1,2-dimethyl-3-phenylpyrazol-2-ium;methyl sulfate;sulfuric acid.
| Compound Name | 5-hexyl-1,2-dimethyl-3-phenylpyrazol-2-ium;methyl sulfate;sulfuric acid |
|---|---|
| PubChem CID | 88833689 |
| Molecular Formula | C18H30N2O8S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 5-hexyl-1,2-dimethyl-3-phenylpyrazol-2-ium;methyl sulfate;sulfuric acid |
| SMILES | CCCCCCc1cc(-c2ccccc2)[n+](C)n1C.COS(=O)(=O)[O-].O=S(=O)(O)O |
| InChI | InChI=1S/C17H25N2.CH4O4S.H2O4S/c1-4-5-6-10-13-16-14-17(19(3)18(16)2)15-11-8-7-9-12-15;1-5-6(2,3)4;1-5(2,3)4/h7-9,11-12,14H,4-6,10,13H2,1-3H3;1H3,(H,2,3,4);(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | ZLVMECQXOMFPRA-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|