About 3-azidoindazol-1-amine
3-azidoindazol-1-amine (PubChem CID 15894035) has the molecular formula C7H6N6
and a molecular weight of 174.17 g/mol. Its IUPAC name is 3-azidoindazol-1-amine.
Molecular Properties
| Compound Name | 3-azidoindazol-1-amine |
| PubChem CID | 15894035 |
| Molecular Formula | C7H6N6 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3-azidoindazol-1-amine |
| SMILES | [N-]=[N+]=Nc1nn(N)c2ccccc12 |
| InChI | InChI=1S/C7H6N6/c8-12-10-7-5-3-1-2-4-6(5)13(9)11-7/h1-4H,9H2 |
| InChIKey | PIVKAZFNJFRJFY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azidoindazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidoindazol-1-amine?
The IUPAC name of 3-azidoindazol-1-amine (CID 15894035) is 3-azidoindazol-1-amine.
What is the SMILES notation for 3-azidoindazol-1-amine?
The canonical SMILES for 3-azidoindazol-1-amine is [N-]=[N+]=Nc1nn(N)c2ccccc12.
What is the InChIKey of 3-azidoindazol-1-amine?
The InChIKey is PIVKAZFNJFRJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N6/c8-12-10-7-5-3-1-2-4-6(5)13(9)11-7/h1-4H,9H2.
What are the key properties of 3-azidoindazol-1-amine?
3-azidoindazol-1-amine has a molecular weight of 174.17 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidoindazol-1-amine is sourced from PubChem (CID 15894035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).