C16H10N8 — CID 14641970
2,3-diazido-5,6-diphenylpyrazine (PubChem CID 14641970) has the molecular formula C16H10N8 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2,3-diazido-5,6-diphenylpyrazine.
| Compound Name | 2,3-diazido-5,6-diphenylpyrazine |
|---|---|
| PubChem CID | 14641970 |
| Molecular Formula | C16H10N8 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2,3-diazido-5,6-diphenylpyrazine |
| SMILES | [N-]=[N+]=Nc1nc(-c2ccccc2)c(-c2ccccc2)nc1N=[N+]=[N-] |
| InChI | InChI=1S/C16H10N8/c17-23-21-15-16(22-24-18)20-14(12-9-5-2-6-10-12)13(19-15)11-7-3-1-4-8-11/h1-10H |
| InChIKey | QNCZKFDXPBEKJR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 123.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|