C16H12ClN5O4 — CID 13157494
2-azido-4,6-diphenylpyrimidine;perchloric acid (PubChem CID 13157494) has the molecular formula C16H12ClN5O4 and a molecular weight of 373.76 g/mol. Its IUPAC name is 2-azido-4,6-diphenylpyrimidine;perchloric acid.
| Compound Name | 2-azido-4,6-diphenylpyrimidine;perchloric acid |
|---|---|
| PubChem CID | 13157494 |
| Molecular Formula | C16H12ClN5O4 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-azido-4,6-diphenylpyrimidine;perchloric acid |
| SMILES | [N-]=[N+]=Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C16H11N5.ClHO4/c17-21-20-16-18-14(12-7-3-1-4-8-12)11-15(19-16)13-9-5-2-6-10-13;2-1(3,4)5/h1-11H;(H,2,3,4,5) |
| InChIKey | OOORVMXKYFFWNG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|