C8H6N6 — CID 137205279
5-azido-3-phenyl-1H-1,2,4-triazole (PubChem CID 137205279) has the molecular formula C8H6N6 and a molecular weight of 186.18 g/mol. Its IUPAC name is 5-azido-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-azido-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 137205279 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 5-azido-3-phenyl-1H-1,2,4-triazole |
| SMILES | [N-]=[N+]=Nc1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C8H6N6/c9-14-13-8-10-7(11-12-8)6-4-2-1-3-5-6/h1-5H,(H,10,11,12) |
| InChIKey | FOMLKWQIODZKHK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|