C9H6Cl3N3 — CID 59302212
3-phenyl-5-(trichloromethyl)-1H-1,2,4-triazole (PubChem CID 59302212) has the molecular formula C9H6Cl3N3 and a molecular weight of 262.53 g/mol. Its IUPAC name is 3-phenyl-5-(trichloromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-phenyl-5-(trichloromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 59302212 |
| Molecular Formula | C9H6Cl3N3 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 3-phenyl-5-(trichloromethyl)-1H-1,2,4-triazole |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C9H6Cl3N3/c10-9(11,12)8-13-7(14-15-8)6-4-2-1-3-5-6/h1-5H,(H,13,14,15) |
| InChIKey | LNYINBJKSTUJTN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|