C14H19N3O — CID 158946335
1-[5-(2-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-2-yl]propan-1-imine (PubChem CID 158946335) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-[5-(2-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-2-yl]propan-1-imine.
| Compound Name | 1-[5-(2-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 158946335 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-[5-(2-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-2-yl]propan-1-imine |
| SMILES | [H]/N=C(\CC)N1CC(C)C(c2ccccc2OC)=N1 |
| InChI | InChI=1S/C14H19N3O/c1-4-13(15)17-9-10(2)14(16-17)11-7-5-6-8-12(11)18-3/h5-8,10,15H,4,9H2,1-3H3/b15-13+ |
| InChIKey | JKWIHKSRTCPHFP-FYWRMAATSA-N |
| XLogP | 2.74 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|