C17H24N4O3 — CID 154508668
5-(2-methoxyphenyl)-4-methyl-N'-(oxan-2-yloxy)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 154508668) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-4-methyl-N'-(oxan-2-yloxy)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(2-methoxyphenyl)-4-methyl-N'-(oxan-2-yloxy)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 154508668 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-(2-methoxyphenyl)-4-methyl-N'-(oxan-2-yloxy)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | COc1ccccc1C1=NN(C(N)=NOC2CCCCO2)CC1C |
| InChI | InChI=1S/C17H24N4O3/c1-12-11-21(17(18)20-24-15-9-5-6-10-23-15)19-16(12)13-7-3-4-8-14(13)22-2/h3-4,7-8,12,15H,5-6,9-11H2,1-2H3,(H2,18,20) |
| InChIKey | SBDIYZFACXKKAI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|