About 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide
3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide (PubChem CID 158950212) has the molecular formula C12H13BrF3NO
and a molecular weight of 324.14 g/mol. Its IUPAC name is 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide |
| PubChem CID | 158950212 |
| Molecular Formula | C12H13BrF3NO |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13BrF3NO/c1-17(2)11(18)6-4-8-3-5-10(13)9(7-8)12(14,15)16/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | CMZUOUZHMPNCSF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide?
The IUPAC name of 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide (CID 158950212) is 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide is CN(C)C(=O)CCc1ccc(Br)c(C(F)(F)F)c1.
What is the InChIKey of 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide?
The InChIKey is CMZUOUZHMPNCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF3NO/c1-17(2)11(18)6-4-8-3-5-10(13)9(7-8)12(14,15)16/h3,5,7H,4,6H2,1-2H3.
What are the key properties of 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide?
3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide has a molecular weight of 324.14 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-bromo-3-(trifluoromethyl)phenyl]-N,N-dimethylpropanamide is sourced from PubChem (CID 158950212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).