C29H26Cl2FN5O — CID 158951090
5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(E)-2-[5-fluoro-2-isocyano-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-1H-indazole (PubChem CID 158951090) has the molecular formula C29H26Cl2FN5O and a molecular weight of 550.47 g/mol. Its IUPAC name is 5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(E)-2-[5-fluoro-2-isocyano-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-1H-indazole.
| Compound Name | 5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(E)-2-[5-fluoro-2-isocyano-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-1H-indazole |
|---|---|
| PubChem CID | 158951090 |
| Molecular Formula | C29H26Cl2FN5O |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-3-[(E)-2-[5-fluoro-2-isocyano-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-1H-indazole |
| SMILES | [C-]#[N+]c1cc(CN2CCCCC2)c(F)cc1/C=C/c1n[nH]c2ccc(OC(C)c3c(Cl)cncc3Cl)cc12 |
| InChI | InChI=1S/C29H26Cl2FN5O/c1-18(29-23(30)15-34-16-24(29)31)38-21-7-9-27-22(14-21)26(35-36-27)8-6-19-12-25(32)20(13-28(19)33-2)17-37-10-4-3-5-11-37/h6-9,12-16,18H,3-5,10-11,17H2,1H3,(H,35,36)/b8-6+ |
| InChIKey | AHBMQJMSWBGFNQ-SOFGYWHQSA-N |
| XLogP | 8.25 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|