C30H37BrN2O2 — CID 158951631
4-[5-bromo-1-(oxan-4-ylmethyl)indol-3-yl]-4-(3-methylphenyl)-1-piperidin-4-ylbutan-2-one (PubChem CID 158951631) has the molecular formula C30H37BrN2O2 and a molecular weight of 537.54 g/mol. Its IUPAC name is 4-[5-bromo-1-(oxan-4-ylmethyl)indol-3-yl]-4-(3-methylphenyl)-1-piperidin-4-ylbutan-2-one.
| Compound Name | 4-[5-bromo-1-(oxan-4-ylmethyl)indol-3-yl]-4-(3-methylphenyl)-1-piperidin-4-ylbutan-2-one |
|---|---|
| PubChem CID | 158951631 |
| Molecular Formula | C30H37BrN2O2 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 4-[5-bromo-1-(oxan-4-ylmethyl)indol-3-yl]-4-(3-methylphenyl)-1-piperidin-4-ylbutan-2-one |
| SMILES | Cc1cccc(C(CC(=O)CC2CCNCC2)c2cn(CC3CCOCC3)c3ccc(Br)cc23)c1 |
| InChI | InChI=1S/C30H37BrN2O2/c1-21-3-2-4-24(15-21)27(18-26(34)16-22-7-11-32-12-8-22)29-20-33(19-23-9-13-35-14-10-23)30-6-5-25(31)17-28(29)30/h2-6,15,17,20,22-23,27,32H,7-14,16,18-19H2,1H3 |
| InChIKey | JLMPOAADXCNWLO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |