C29H37N3O — CID 142579389
3-[1-(cyclopentylmethyl)indol-3-yl]-3-(3-methylphenyl)-N-piperidin-4-ylpropanamide (PubChem CID 142579389) has the molecular formula C29H37N3O and a molecular weight of 443.64 g/mol. Its IUPAC name is 3-[1-(cyclopentylmethyl)indol-3-yl]-3-(3-methylphenyl)-N-piperidin-4-ylpropanamide.
| Compound Name | 3-[1-(cyclopentylmethyl)indol-3-yl]-3-(3-methylphenyl)-N-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 142579389 |
| Molecular Formula | C29H37N3O |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 3-[1-(cyclopentylmethyl)indol-3-yl]-3-(3-methylphenyl)-N-piperidin-4-ylpropanamide |
| SMILES | Cc1cccc(C(CC(=O)NC2CCNCC2)c2cn(CC3CCCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C29H37N3O/c1-21-7-6-10-23(17-21)26(18-29(33)31-24-13-15-30-16-14-24)27-20-32(19-22-8-2-3-9-22)28-12-5-4-11-25(27)28/h4-7,10-12,17,20,22,24,26,30H,2-3,8-9,13-16,18-19H2,1H3,(H,31,33) |
| InChIKey | OGCJANMJMSEIFB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |