C32H42N2O2 — CID 142579601
N-cyclohexyl-3-[1-(cyclohexylmethyl)-5-methoxyindol-3-yl]-3-(3-methylphenyl)propanamide (PubChem CID 142579601) has the molecular formula C32H42N2O2 and a molecular weight of 486.70 g/mol. Its IUPAC name is N-cyclohexyl-3-[1-(cyclohexylmethyl)-5-methoxyindol-3-yl]-3-(3-methylphenyl)propanamide.
| Compound Name | N-cyclohexyl-3-[1-(cyclohexylmethyl)-5-methoxyindol-3-yl]-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 142579601 |
| Molecular Formula | C32H42N2O2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | N-cyclohexyl-3-[1-(cyclohexylmethyl)-5-methoxyindol-3-yl]-3-(3-methylphenyl)propanamide |
| SMILES | COc1ccc2c(c1)c(C(CC(=O)NC1CCCCC1)c1cccc(C)c1)cn2CC1CCCCC1 |
| InChI | InChI=1S/C32H42N2O2/c1-23-10-9-13-25(18-23)28(20-32(35)33-26-14-7-4-8-15-26)30-22-34(21-24-11-5-3-6-12-24)31-17-16-27(36-2)19-29(30)31/h9-10,13,16-19,22,24,26,28H,3-8,11-12,14-15,20-21H2,1-2H3,(H,33,35) |
| InChIKey | DQLRJZCNZNYKLE-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |