C32H42ClN3O3 — CID 166691488
4-[[3-[1-(cyclohexylmethyl)indol-3-yl]-3-(3-methylphenyl)propanoyl]amino]-N-hydroxycyclohexane-1-carboxamide;hydrochloride (PubChem CID 166691488) has the molecular formula C32H42ClN3O3 and a molecular weight of 552.16 g/mol. Its IUPAC name is 4-[[3-[1-(cyclohexylmethyl)indol-3-yl]-3-(3-methylphenyl)propanoyl]amino]-N-hydroxycyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 4-[[3-[1-(cyclohexylmethyl)indol-3-yl]-3-(3-methylphenyl)propanoyl]amino]-N-hydroxycyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 166691488 |
| Molecular Formula | C32H42ClN3O3 |
| Molecular Weight | 552.16 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 4-[[3-[1-(cyclohexylmethyl)indol-3-yl]-3-(3-methylphenyl)propanoyl]amino]-N-hydroxycyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cc1cccc(C(CC(=O)NC2CCC(C(=O)NO)CC2)c2cn(CC3CCCCC3)c3ccccc23)c1.Cl |
| InChI | InChI=1S/C32H41N3O3.ClH/c1-22-8-7-11-25(18-22)28(19-31(36)33-26-16-14-24(15-17-26)32(37)34-38)29-21-35(20-23-9-3-2-4-10-23)30-13-6-5-12-27(29)30;/h5-8,11-13,18,21,23-24,26,28,38H,2-4,9-10,14-17,19-20H2,1H3,(H,33,36)(H,34,37);1H |
| InChIKey | YJAPVSQWOVUTOQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.16 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|