C33H43N3O3 — CID 142579603
3-[1-(cyclohexylmethyl)indol-3-yl]-N-[4-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-3-(3-methylphenyl)propanamide (PubChem CID 142579603) has the molecular formula C33H43N3O3 and a molecular weight of 529.73 g/mol. Its IUPAC name is 3-[1-(cyclohexylmethyl)indol-3-yl]-N-[4-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-3-(3-methylphenyl)propanamide.
| Compound Name | 3-[1-(cyclohexylmethyl)indol-3-yl]-N-[4-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 142579603 |
| Molecular Formula | C33H43N3O3 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 3-[1-(cyclohexylmethyl)indol-3-yl]-N-[4-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(C(CC(=O)NC2CCC(CC(=O)NO)CC2)c2cn(CC3CCCCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C33H43N3O3/c1-23-8-7-11-26(18-23)29(20-32(37)34-27-16-14-24(15-17-27)19-33(38)35-39)30-22-36(21-25-9-3-2-4-10-25)31-13-6-5-12-28(30)31/h5-8,11-13,18,22,24-25,27,29,39H,2-4,9-10,14-17,19-21H2,1H3,(H,34,37)(H,35,38) |
| InChIKey | OQDKYMTXTTYHJB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|