C15H8F4N2S — CID 158954496
2-(3-fluoro-4-methylphenyl)-5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazole (PubChem CID 158954496) has the molecular formula C15H8F4N2S and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 158954496 |
| Molecular Formula | C15H8F4N2S |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazole |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(F)c(F)c3F)s2)cc1F |
| InChI | InChI=1S/C15H8F4N2S/c1-7-2-3-8(6-11(7)17)14-20-21-15(22-14)9-4-5-10(16)13(19)12(9)18/h2-6H,1H3 |
| InChIKey | JLVJGRCVSDUUKA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|