C6H12BrO3P2+ — CID 158955476
[[(E)-4-bromobut-2-enyl]-methylphosphoryl]oxy-methyl-oxophosphanium (PubChem CID 158955476) has the molecular formula C6H12BrO3P2+ and a molecular weight of 274.01 g/mol. Its IUPAC name is [[(E)-4-bromobut-2-enyl]-methylphosphoryl]oxy-methyl-oxophosphanium.
| Compound Name | [[(E)-4-bromobut-2-enyl]-methylphosphoryl]oxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 158955476 |
| Molecular Formula | C6H12BrO3P2+ |
| Molecular Weight | 274.01 g/mol |
| Exact Mass | 272.94 |
| IUPAC Name | [[(E)-4-bromobut-2-enyl]-methylphosphoryl]oxy-methyl-oxophosphanium |
| SMILES | C[P+](=O)OP(C)(=O)C/C=C/CBr |
| InChI | InChI=1S/C6H12BrO3P2/c1-11(8)10-12(2,9)6-4-3-5-7/h3-4H,5-6H2,1-2H3/q+1/b4-3+ |
| InChIKey | DIRIMJMTCJZEMQ-ONEGZZNKSA-N |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.01 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|