C14H20N2O5S2 — CID 15895613
N-hydroxy-3-(4-methoxyphenyl)sulfonyl-2,5,5-trimethyl-1,3-thiazolidine-2-carboxamide (PubChem CID 15895613) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-hydroxy-3-(4-methoxyphenyl)sulfonyl-2,5,5-trimethyl-1,3-thiazolidine-2-carboxamide.
| Compound Name | N-hydroxy-3-(4-methoxyphenyl)sulfonyl-2,5,5-trimethyl-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 15895613 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-hydroxy-3-(4-methoxyphenyl)sulfonyl-2,5,5-trimethyl-1,3-thiazolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)(C)SC2(C)C(=O)NO)cc1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-13(2)9-16(14(3,22-13)12(17)15-18)23(19,20)11-7-5-10(21-4)6-8-11/h5-8,18H,9H2,1-4H3,(H,15,17) |
| InChIKey | MYIAZQIHYVKQLZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|