C16H23N3O6S — CID 139845074
N-hydroxy-2-[1-(4-methoxyphenyl)sulfonyl-3,5,5-trimethyl-4-oxo-1,3-diazinan-2-yl]acetamide (PubChem CID 139845074) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is N-hydroxy-2-[1-(4-methoxyphenyl)sulfonyl-3,5,5-trimethyl-4-oxo-1,3-diazinan-2-yl]acetamide.
| Compound Name | N-hydroxy-2-[1-(4-methoxyphenyl)sulfonyl-3,5,5-trimethyl-4-oxo-1,3-diazinan-2-yl]acetamide |
|---|---|
| PubChem CID | 139845074 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-hydroxy-2-[1-(4-methoxyphenyl)sulfonyl-3,5,5-trimethyl-4-oxo-1,3-diazinan-2-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)(C)C(=O)N(C)C2CC(=O)NO)cc1 |
| InChI | InChI=1S/C16H23N3O6S/c1-16(2)10-19(14(9-13(20)17-22)18(3)15(16)21)26(23,24)12-7-5-11(25-4)6-8-12/h5-8,14,22H,9-10H2,1-4H3,(H,17,20) |
| InChIKey | ZHRXTTKWHVNABV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|