C17H19F3N2O3 — CID 158956664
ethanamine;1-ethyl-4-oxo-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 158956664) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is ethanamine;1-ethyl-4-oxo-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | ethanamine;1-ethyl-4-oxo-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158956664 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | ethanamine;1-ethyl-4-oxo-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | CCN.CCn1cc(C(=O)O)c(=O)cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3NO3.C2H7N/c1-2-19-8-11(14(21)22)13(20)7-12(19)9-4-3-5-10(6-9)15(16,17)18;1-2-3/h3-8H,2H2,1H3,(H,21,22);2-3H2,1H3 |
| InChIKey | JMBYBSHOWAULKB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |