C23H31INO3- — CID 158958056
4-[(E)-2-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethenyl]-N,N-dimethyl-2-methyliodanuidylaniline (PubChem CID 158958056) has the molecular formula C23H31INO3- and a molecular weight of 496.41 g/mol. Its IUPAC name is 4-[(E)-2-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethenyl]-N,N-dimethyl-2-methyliodanuidylaniline.
| Compound Name | 4-[(E)-2-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethenyl]-N,N-dimethyl-2-methyliodanuidylaniline |
|---|---|
| PubChem CID | 158958056 |
| Molecular Formula | C23H31INO3- |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-[(E)-2-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]ethenyl]-N,N-dimethyl-2-methyliodanuidylaniline |
| SMILES | CCOCCOCCOc1ccc(/C=C/c2ccc(N(C)C)c([I-]C)c2)cc1 |
| InChI | InChI=1S/C23H31INO3/c1-5-26-14-15-27-16-17-28-21-11-8-19(9-12-21)6-7-20-10-13-23(25(3)4)22(18-20)24-2/h6-13,18H,5,14-17H2,1-4H3/q-1/b7-6+ |
| InChIKey | MLFRKFWHRGWARQ-VOTSOKGWSA-N |
| XLogP | 1.24 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|