C16H8Br2F8O — CID 158959761
1-bromo-4-ethenyl-2,3,5,6-tetrafluorobenzene;1-(4-bromo-2,3,5,6-tetrafluorophenyl)ethanol (PubChem CID 158959761) has the molecular formula C16H8Br2F8O and a molecular weight of 528.03 g/mol. Its IUPAC name is 1-bromo-4-ethenyl-2,3,5,6-tetrafluorobenzene;1-(4-bromo-2,3,5,6-tetrafluorophenyl)ethanol.
| Compound Name | 1-bromo-4-ethenyl-2,3,5,6-tetrafluorobenzene;1-(4-bromo-2,3,5,6-tetrafluorophenyl)ethanol |
|---|---|
| PubChem CID | 158959761 |
| Molecular Formula | C16H8Br2F8O |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 525.88 |
| IUPAC Name | 1-bromo-4-ethenyl-2,3,5,6-tetrafluorobenzene;1-(4-bromo-2,3,5,6-tetrafluorophenyl)ethanol |
| SMILES | C=Cc1c(F)c(F)c(Br)c(F)c1F.CC(O)c1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C8H5BrF4O.C8H3BrF4/c1-2(14)3-5(10)7(12)4(9)8(13)6(3)11;1-2-3-5(10)7(12)4(9)8(13)6(3)11/h2,14H,1H3;2H,1H2 |
| InChIKey | JMLULSUPHKHBQS-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|