C30H34N4O3 — CID 158962074
4-[4-(C,N-dimethylcarbonimidoyl)-1,4-diazepan-1-yl]-N-[2-hydroxy-6-[2-(4-methylphenyl)-2-oxoethyl]phenyl]benzamide (PubChem CID 158962074) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 4-[4-(C,N-dimethylcarbonimidoyl)-1,4-diazepan-1-yl]-N-[2-hydroxy-6-[2-(4-methylphenyl)-2-oxoethyl]phenyl]benzamide.
| Compound Name | 4-[4-(C,N-dimethylcarbonimidoyl)-1,4-diazepan-1-yl]-N-[2-hydroxy-6-[2-(4-methylphenyl)-2-oxoethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 158962074 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 4-[4-(C,N-dimethylcarbonimidoyl)-1,4-diazepan-1-yl]-N-[2-hydroxy-6-[2-(4-methylphenyl)-2-oxoethyl]phenyl]benzamide |
| SMILES | C/N=C(\C)N1CCCN(c2ccc(C(=O)Nc3c(O)cccc3CC(=O)c3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H34N4O3/c1-21-8-10-23(11-9-21)28(36)20-25-6-4-7-27(35)29(25)32-30(37)24-12-14-26(15-13-24)34-17-5-16-33(18-19-34)22(2)31-3/h4,6-15,35H,5,16-20H2,1-3H3,(H,32,37)/b31-22+ |
| InChIKey | JMTADBUYHDRALW-DFKUXCBWSA-N |
| XLogP | 4.94 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|