C33H34N4O3 — CID 59108382
N-[2-[[4-(4-benzyl-1,4-diazepan-1-yl)benzoyl]amino]-3-hydroxyphenyl]-4-methylbenzamide (PubChem CID 59108382) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[2-[[4-(4-benzyl-1,4-diazepan-1-yl)benzoyl]amino]-3-hydroxyphenyl]-4-methylbenzamide.
| Compound Name | N-[2-[[4-(4-benzyl-1,4-diazepan-1-yl)benzoyl]amino]-3-hydroxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 59108382 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | N-[2-[[4-(4-benzyl-1,4-diazepan-1-yl)benzoyl]amino]-3-hydroxyphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(O)c2NC(=O)c2ccc(N3CCCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O3/c1-24-11-13-26(14-12-24)32(39)34-29-9-5-10-30(38)31(29)35-33(40)27-15-17-28(18-16-27)37-20-6-19-36(21-22-37)23-25-7-3-2-4-8-25/h2-5,7-18,38H,6,19-23H2,1H3,(H,34,39)(H,35,40) |
| InChIKey | JRZATPGXOGGPKY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|