C29H35ClN4O5 — CID 162338663
N-[2-hydroxy-6-[(4-methoxybenzoyl)amino]phenyl]-4-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]benzamide;hydrochloride (PubChem CID 162338663) has the molecular formula C29H35ClN4O5 and a molecular weight of 555.08 g/mol. Its IUPAC name is N-[2-hydroxy-6-[(4-methoxybenzoyl)amino]phenyl]-4-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]benzamide;hydrochloride.
| Compound Name | N-[2-hydroxy-6-[(4-methoxybenzoyl)amino]phenyl]-4-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 162338663 |
| Molecular Formula | C29H35ClN4O5 |
| Molecular Weight | 555.08 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | N-[2-hydroxy-6-[(4-methoxybenzoyl)amino]phenyl]-4-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]benzamide;hydrochloride |
| SMILES | COCCN1CCCN(c2ccc(C(=O)Nc3c(O)cccc3NC(=O)c3ccc(OC)cc3)cc2)CC1.Cl |
| InChI | InChI=1S/C29H34N4O5.ClH/c1-37-20-19-32-15-4-16-33(18-17-32)23-11-7-21(8-12-23)29(36)31-27-25(5-3-6-26(27)34)30-28(35)22-9-13-24(38-2)14-10-22;/h3,5-14,34H,4,15-20H2,1-2H3,(H,30,35)(H,31,36);1H |
| InChIKey | BSZTYCBBAMPRHB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.08 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|