C7H5Br2N3 — CID 15896585
3,5-dibromo-2H-indazol-7-amine (PubChem CID 15896585) has the molecular formula C7H5Br2N3 and a molecular weight of 290.95 g/mol. Its IUPAC name is 3,5-dibromo-2H-indazol-7-amine.
| Compound Name | 3,5-dibromo-2H-indazol-7-amine |
|---|---|
| PubChem CID | 15896585 |
| Molecular Formula | C7H5Br2N3 |
| Molecular Weight | 290.95 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | 3,5-dibromo-2H-indazol-7-amine |
| SMILES | Nc1cc(Br)cc2c(Br)[nH]nc12 |
| InChI | InChI=1S/C7H5Br2N3/c8-3-1-4-6(5(10)2-3)11-12-7(4)9/h1-2H,10H2,(H,11,12) |
| InChIKey | QAQPCHDWYQUGBI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.95 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|