C11H26O3 — CID 158972079
methane;2-(2-methoxyethoxy)-1-prop-2-enoxypropane (PubChem CID 158972079) has the molecular formula C11H26O3 and a molecular weight of 206.33 g/mol. Its IUPAC name is methane;2-(2-methoxyethoxy)-1-prop-2-enoxypropane.
| Compound Name | methane;2-(2-methoxyethoxy)-1-prop-2-enoxypropane |
|---|---|
| PubChem CID | 158972079 |
| Molecular Formula | C11H26O3 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.19 |
| IUPAC Name | methane;2-(2-methoxyethoxy)-1-prop-2-enoxypropane |
| SMILES | C.C.C=CCOCC(C)OCCOC |
| InChI | InChI=1S/C9H18O3.2CH4/c1-4-5-11-8-9(2)12-7-6-10-3;;/h4,9H,1,5-8H2,2-3H3;2*1H4 |
| InChIKey | JNYASGHXSUMQQZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|