C21H43O7- — CID 172636483
(2S)-2-[(2R)-2-[(2R)-2-[(2S)-2-[(2S)-2-(2-methoxyethoxy)propoxy]propoxy]propoxy]propoxy]-1-[(2R)-propan-2-yl]oxypropane (PubChem CID 172636483) has the molecular formula C21H43O7- and a molecular weight of 407.57 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-[(2R)-2-[(2S)-2-[(2S)-2-(2-methoxyethoxy)propoxy]propoxy]propoxy]propoxy]-1-[(2R)-propan-2-yl]oxypropane.
| Compound Name | (2S)-2-[(2R)-2-[(2R)-2-[(2S)-2-[(2S)-2-(2-methoxyethoxy)propoxy]propoxy]propoxy]propoxy]-1-[(2R)-propan-2-yl]oxypropane |
|---|---|
| PubChem CID | 172636483 |
| Molecular Formula | C21H43O7- |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | (2S)-2-[(2R)-2-[(2R)-2-[(2S)-2-[(2S)-2-(2-methoxyethoxy)propoxy]propoxy]propoxy]propoxy]-1-[(2R)-propan-2-yl]oxypropane |
| SMILES | [CH2-][C@H](C)OC[C@H](C)OC[C@@H](C)OC[C@@H](C)OC[C@H](C)OC[C@H](C)OCCOC |
| InChI | InChI=1S/C21H43O7/c1-16(2)24-11-18(4)26-13-20(6)28-15-21(7)27-14-19(5)25-12-17(3)23-10-9-22-8/h16-21H,1,9-15H2,2-8H3/q-1/t16-,17+,18+,19+,20-,21-/m1/s1 |
| InChIKey | IMJDSQDFXQZECU-ZZAJFKAYSA-N |
| XLogP | 2.90 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|