C13H15IN4OS — CID 158973963
methyl N'-(2-methyl-6-phenoxypyrimidin-4-yl)carbamimidothioate;hydroiodide (PubChem CID 158973963) has the molecular formula C13H15IN4OS and a molecular weight of 402.26 g/mol. Its IUPAC name is methyl N'-(2-methyl-6-phenoxypyrimidin-4-yl)carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-(2-methyl-6-phenoxypyrimidin-4-yl)carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 158973963 |
| Molecular Formula | C13H15IN4OS |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | methyl N'-(2-methyl-6-phenoxypyrimidin-4-yl)carbamimidothioate;hydroiodide |
| SMILES | CSC(N)=Nc1cc(Oc2ccccc2)nc(C)n1.I |
| InChI | InChI=1S/C13H14N4OS.HI/c1-9-15-11(17-13(14)19-2)8-12(16-9)18-10-6-4-3-5-7-10;/h3-8H,1-2H3,(H2,14,15,16,17);1H |
| InChIKey | JODOUFXFLHQUEK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|